Systematic / IUPAC Name: 2-(Pentamethylbenzoyl)-N-(3-pyridinylmethyl)benzamide
ID: Reference4616
Other Names: Benzamide, 2-(2,3,4,5,6-pentamethylbenzoyl)-N-(3-pyridinylmethyl)-
Formula: C25H26N2O2
N1-(3-Pyridylmethyl)-2-(2,3,4,5,6-pentamethylbenzoyl)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/25/2016 7:52:31 AM |
| InChI | InChI=1S/C25H26N2O2/c1-15-16(2)18(4)23(19(5)17(15)3)24(28)21-10-6-7-11-22(21)25(29)27-14-20-9-8-12-26-13-20/h6-13H,14H2,1-5H3,(H,27,29) |
| InChI Key | YMBDFYCUSLLAPN-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=C(C(=C1C)C)C(=O)C2=CC=CC=C2C(=O)NCC3=CN=CC=C3)C)C |
| CAS | |
| Splash | |
| Other Names | Benzamide, 2-(2,3,4,5,6-pentamethylbenzoyl)-N-(3-pyridinylmethyl)- |