Systematic / IUPAC Name: 1,1'-{1,2,4-Thiadiazole-3,5-diylbis[sulfanediylmethylene(4-methoxy-3,1-phenylene)]}diethanone
ID: Reference4621
Other Names: Ethanone, 1,1'-{1,2,4-thiadiazole-3,5-diylbis[thiomethylene(4-methoxy-3,1-phenylene)]}bis-
Formula: C22H22N2O4S3
1-{3-[({3-[(5-Acetyl-2-methoxybenzyl)thio]-1,2,4-thiadiazol-5-yl}thio)methyl]-4-methoxyphenyl}ethan-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/25/2016 9:07:46 AM |
| InChI | InChI=1S/C22H22N2O4S3/c1-13(25)15-5-7-19(27-3)17(9-15)11-29-21-23-22(31-24-21)30-12-18-10-16(14(2)26)6-8-20(18)28-4/h5-10H,11-12H2,1-4H3 |
| InChI Key | HWDYVBDILRNQDK-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)C1=CC(=C(C=C1)OC)CSC2=NSC(=N2)SCC3=C(C=CC(=C3)C(=O)C)OC |
| CAS | |
| Splash | |
| Other Names | Ethanone, 1,1'-{1,2,4-thiadiazole-3,5-diylbis[thiomethylene(4-methoxy-3,1-phenylene)]}bis- |