Systematic / IUPAC Name: N-Methyl-4-(5-propyl-2-pyrimidinyl)-1-piperazinecarbothioamide
ID: Reference4638
Other Names: 1-Piperazinecarbothioamide, N-methyl-4-(5-propyl-2-pyrimidinyl)-
Formula: C13H21N5S
N-Methyl-4-(5-propyl-2-pyrimidinyl)tetrahydro-1(2H)-pyrazinecarbothioamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/26/2016 6:50:11 AM |
| InChI | InChI=1S/C13H21N5S/c1-3-4-11-9-15-12(16-10-11)17-5-7-18(8-6-17)13(19)14-2/h9-10H,3-8H2,1-2H3,(H,14,19) |
| InChI Key | ZNZYIZYPUAHJKT-UHFFFAOYSA-N |
| Canonical SMILES | CCCC1=CN=C(N=C1)N2CCN(CC2)C(=S)NC |
| CAS | |
| Splash | |
| Other Names | 1-Piperazinecarbothioamide, N-methyl-4-(5-propyl-2-pyrimidinyl)- |
| PubChem | 2811495 |
| ChemSpider | 2089906 |
| ChEMBL | CHEMBL1609965 |