Systematic / IUPAC Name: 2-(4-Chlorophenoxy)-5-(4-methyl-1,3-thiazol-2-yl)pyridine
ID: Reference4642
Other Names: Pyridine, 2-(4-chlorophenoxy)-5-(4-methyl-2-thiazolyl)-
Formula: C15H11ClN2OS
2-[6-(4-Chlorophenoxy)-3-pyridyl]-4-methyl-1,3-thiazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/26/2016 8:19:45 AM |
| InChI | InChI=1S/C15H11ClN2OS/c1-10-9-20-15(18-10)11-2-7-14(17-8-11)19-13-5-3-12(16)4-6-13/h2-9H,1H3 |
| InChI Key | SKWBAKSNCLXOLO-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CSC(=N1)C2=CN=C(C=C2)OC3=CC=C(C=C3)Cl |
| CAS | |
| Splash | |
| Other Names | Pyridine, 2-(4-chlorophenoxy)-5-(4-methyl-2-thiazolyl)- |