Systematic / IUPAC Name: (3Z)-4-Hydroxy-3-{[5-(methylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl}-3-penten-2-one
ID: Reference4645
Other Names: 3-Penten-2-one, 4-hydroxy-3-{[5-(methylthio)-1,3,4-thiadiazol-2-yl]thio}-, (3Z)-
Formula: C8H10N2O2S3
4-Hydroxy-3-{[5-(methylthio)-1,3,4-thiadiazol-2-yl]thio}pent-3-en-2-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/26/2016 8:36:55 AM |
| InChI | InChI=1S/C8H10N2O2S3/c1-4(11)6(5(2)12)14-8-10-9-7(13-3)15-8/h11H,1-3H3/b6-4- |
| InChI Key | ZGFCGPIQLOURTI-XQRVVYSFSA-N |
| Canonical SMILES | CC(=C(C(=O)C)SC1=NN=C(S1)SC)O |
| CAS | |
| Splash | |
| Other Names | 3-Penten-2-one, 4-hydroxy-3-{[5-(methylthio)-1,3,4-thiadiazol-2-yl]thio}-, (3Z)- |