Systematic / IUPAC Name: N-(3-Amino-4-chlorophenyl)-2-hydroxybenzamide
ID: Reference4656
Other Names:
N1-(3-Amino-4-chlorophenyl)-2-hydroxybenzamide ;
Benzamide, N-(3-amino-4-chlorophenyl)-2-hydroxy-
Formula: C13H11ClN2O2
N-(3-Amino-4-chlorophenyl)-2-hydroxybenzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/26/2016 11:59:20 AM |
| InChI | InChI=1S/C13H11ClN2O2/c14-10-6-5-8(7-11(10)15)16-13(18)9-3-1-2-4-12(9)17/h1-7,17H,15H2,(H,16,18) |
| InChI Key | YWYXXXCBIQVHIE-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC(=C(C=C2)Cl)N)O |
| CAS | |
| Splash | |
| Other Names |
N1-(3-Amino-4-chlorophenyl)-2-hydroxybenzamide ; Benzamide, N-(3-amino-4-chlorophenyl)-2-hydroxy- |