Systematic / IUPAC Name: Allyl (1Z)-2-(1H-benzimidazol-2-yl)-2-cyano-N-phenylethanimidothioate
ID: Reference4660
Other Names: 1H-Benzimidazole-2-ethanimidothioic acid, α-cyano-N-phenyl-, 2-propen-1-yl ester
Formula: C19H16N4S
Allyl 2-(1H-benzimidazol-2-yl)-2-cyano-N-phenylethanimidothioate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/26/2016 11:52:56 AM |
| InChI | InChI=1S/C19H16N4S/c1-2-12-24-19(21-14-8-4-3-5-9-14)15(13-20)18-22-16-10-6-7-11-17(16)23-18/h2-11,15H,1,12H2,(H,22,23)/b21-19- |
| InChI Key | HZILCQONIALCAS-VZCXRCSSSA-N |
| Canonical SMILES | C=CCSC(=NC1=CC=CC=C1)C(C#N)C2=NC3=CC=CC=C3N2 |
| CAS | |
| Splash | |
| Other Names | 1H-Benzimidazole-2-ethanimidothioic acid, α-cyano-N-phenyl-, 2-propen-1-yl ester |