Systematic / IUPAC Name: Methyl N-cyano-N'-(2-pyridinylmethyl)carbamimidothioate
ID: Reference4662
Other Names: Carbamimidothioic acid, N-cyano-N'-(2-pyridinylmethyl), methyl ester
Formula: C9H10N4S
2-({[(Cyanoimino)(methylthio)methyl]amino}methyl)pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/26/2016 12:32:34 PM |
| InChI | InChI=1S/C9H10N4S/c1-14-9(13-7-10)12-6-8-4-2-3-5-11-8/h2-5H,6H2,1H3,(H,12,13) |
| InChI Key | MCYAAHNWXIUMFS-UHFFFAOYSA-N |
| Canonical SMILES | CSC(=NCC1=CC=CC=N1)NC#N |
| CAS | |
| Splash | |
| Other Names | Carbamimidothioic acid, N-cyano-N'-(2-pyridinylmethyl), methyl ester |