Systematic / IUPAC Name: 5-[2-(Benzyloxy)-3,6-dimethoxyphenyl]-1H-pyrazole
ID: Reference4669
Other Names: 1H-Pyrazole, 5-[3,6-dimethoxy-2-(phenylmethoxy)phenyl]-
Formula: C18H18N2O3
3-[2-(Benzyloxy)-3,6-dimethoxyphenyl]-1H-pyrazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/27/2016 5:49:18 AM |
| InChI | InChI=1S/C18H18N2O3/c1-21-15-8-9-16(22-2)18(17(15)14-10-11-19-20-14)23-12-13-6-4-3-5-7-13/h3-11H,12H2,1-2H3,(H,19,20) |
| InChI Key | SXANKDJNFANLSS-UHFFFAOYSA-N |
| Canonical SMILES | COC1=C(C(=C(C=C1)OC)OCC2=CC=CC=C2)C3=CC=NN3 |
| CAS | |
| Splash | |
| Other Names | 1H-Pyrazole, 5-[3,6-dimethoxy-2-(phenylmethoxy)phenyl]- |