Systematic / IUPAC Name: Dimethyl 2,6-dimethyl-4-(2-thienyl)-3,5-pyridinedicarboxylate
ID: Reference4679
Other Names:
2,6-Dimethyl-4-thiophen-2-yl-pyridine-3,5-dicarboxylic acid dimethyl ester;
Dimethyl 2,6-dimethyl-4-(thiophen-2-yl)pyridine-3,5-dicarboxylate;
Methyl 5-(methoxycarbonyl)-2,6-dimethyl-4-(2-thienyl)pyridine-3-carboxylate
Formula: C15H15NO4S
Dimethyl 2,6-dimethyl-4-(2-thienyl)pyridine-3,5-dicarboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/27/2016 8:11:01 AM |
| InChI | InChI=1S/C15H15NO4S/c1-8-11(14(17)19-3)13(10-6-5-7-21-10)12(9(2)16-8)15(18)20-4/h5-7H,1-4H3 |
| InChI Key | SLZGKILOTAGHIY-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=C(C(=N1)C)C(=O)OC)C2=CC=CS2)C(=O)OC |
| CAS | |
| Splash | |
| Other Names |
2,6-Dimethyl-4-thiophen-2-yl-pyridine-3,5-dicarboxylic acid dimethyl ester; Dimethyl 2,6-dimethyl-4-(thiophen-2-yl)pyridine-3,5-dicarboxylate; Methyl 5-(methoxycarbonyl)-2,6-dimethyl-4-(2-thienyl)pyridine-3-carboxylate |
| ChEMBL | CHEMBL1898642 |
| PubChem | 714649 |
| ChemSpider | 623526 |