Systematic / IUPAC Name: 3,5-Dimethyl-N-{[5-(methylsulfanyl)-2-thienyl]methyl}-1,2-oxazole-4-carboxamide
ID: Reference4685
Other Names: 4-Isoxazolecarboxamide, 3,5-dimethyl-N-{[5-(methylthio)-2-thienyl]methyl}-
Formula: C12H14N2O2S2
N4-{[5-(Methylthio)-2-thienyl]methyl}-3,5-dimethylisoxazole-4-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/27/2016 10:41:03 AM |
| InChI | InChI=1S/C12H14N2O2S2/c1-7-11(8(2)16-14-7)12(15)13-6-9-4-5-10(17-3)18-9/h4-5H,6H2,1-3H3,(H,13,15) |
| InChI Key | LDEWAVCZLXNVMN-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=NO1)C)C(=O)NCC2=CC=C(S2)SC |
| CAS | |
| Splash | |
| Other Names | 4-Isoxazolecarboxamide, 3,5-dimethyl-N-{[5-(methylthio)-2-thienyl]methyl}- |
| PubChem | 2740429 |
| ChemSpider | 2022022 |
| ChEMBL | CHEMBL1864791 |