Systematic / IUPAC Name: Methyl N-(adamantan-1-yl)hydrazinecarbimidothioate
ID: Reference4702
Other Names: Hydrazinecarboximidothioic acid, N-tricyclo[3.3.1.13,7]dec-1-yl, methyl ester
Formula: C12H21N3S
Methyl (1-adamantylamino)methanehydrazonothioate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/28/2016 8:21:55 AM |
| InChI | InChI=1S/C12H21N3S/c1-16-11(15-13)14-12-5-8-2-9(6-12)4-10(3-8)7-12/h8-10H,2-7,13H2,1H3,(H,14,15) |
| InChI Key | GYSYBBZNIBNVES-UHFFFAOYSA-N |
| Canonical SMILES | CSC(=NC12CC3CC(C1)CC(C3)C2)NN |
| CAS | |
| Splash | |
| Other Names | Hydrazinecarboximidothioic acid, N-tricyclo[3.3.1.13,7]dec-1-yl, methyl ester |