Systematic / IUPAC Name: (4Z)-1-(4-Chlorophenyl)-4-{[(4-chlorophenyl)amino](phenyl)methylene}-5-thioxo-2,3-pyrrolidinedione
ID: Reference4703
Other Names:
Formula: C23H14Cl2N2O2S
4-[(4-Chloroanilino)(phenyl)methylidene]-1-(4-chlorophenyl)-5-thioxopyrrolidine-2,3-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/28/2016 8:22:52 AM |
| InChI | InChI=1S/C23H14Cl2N2O2S/c24-15-6-10-17(11-7-15)26-20(14-4-2-1-3-5-14)19-21(28)22(29)27(23(19)30)18-12-8-16(25)9-13-18/h1-13,26H/b20-19- |
| InChI Key | DEUZGKRUOOUGCX-VXPUYCOJSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(=C2C(=O)C(=O)N(C2=S)C3=CC=C(C=C3)Cl)NC4=CC=C(C=C4)Cl |
| CAS | |
| Splash | |
| Other Names |