Systematic / IUPAC Name: 2-({5-[(4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-1,3,4-oxadiazol-2-yl}sulfanyl)-1-(4-chlorophenyl)ethanone
ID: Reference4709
Other Names: Ethanone, 2-({5-[(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-1,3,4-oxadiazol-2-yl}thio)-1-(4-chlorophenyl)-
Formula: C16H14BrClN4O2S
2-({5-[(4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-1,3,4-oxadiazol-2-yl}thio)-1-(4-chlorophenyl)ethan-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/28/2016 12:58:16 PM |
| InChI | InChI=1S/C16H14BrClN4O2S/c1-9-15(17)10(2)22(21-9)7-14-19-20-16(24-14)25-8-13(23)11-3-5-12(18)6-4-11/h3-6H,7-8H2,1-2H3 |
| InChI Key | RNYYTOLTIKKNBG-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=NN1CC2=NN=C(O2)SCC(=O)C3=CC=C(C=C3)Cl)C)Br |
| CAS | |
| Splash | |
| Other Names | Ethanone, 2-({5-[(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)methyl]-1,3,4-oxadiazol-2-yl}thio)-1-(4-chlorophenyl)- |