Systematic / IUPAC Name: 3-[5-(2-Pyridinyl)-2-thienyl]-2-propyn-1-yl phenylcarbamate
ID: Reference4714
Other Names:
Formula: C19H14N2O2S
3-[5-(2-Pyridyl)-2-thienyl]prop-2-ynyl N-phenylcarbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/29/2016 8:41:31 AM |
| InChI | InChI=1S/C19H14N2O2S/c22-19(21-15-7-2-1-3-8-15)23-14-6-9-16-11-12-18(24-16)17-10-4-5-13-20-17/h1-5,7-8,10-13H,14H2,(H,21,22) |
| InChI Key | VZIWVCIUVCZSCU-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)NC(=O)OCC#CC2=CC=C(S2)C3=CC=CC=N3 |
| CAS | |
| Splash | |
| Other Names |