Systematic / IUPAC Name: 2-Amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-
oxopentanoic acid
ID: Reference472
Other Names:
Isethion;
Copren;
Tathion;
Reduced glutathione;
Deltathione
; more
Formula: C10H17N3O6S
Class: Endogenous Metabolites
L-Glutathione (reduced) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 2654 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 1/26/2015 10:57:53 AM |
| InChI | InChI=1S/C10H17N3O6S/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1 |
| InChI Key | RWSXRVCMGQZWBV-WDSKDSINSA-N |
| Canonical SMILES | C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N |
| CAS | 70188 |
| Splash | |
| Other Names |
Isethion; Copren; Tathion; Reduced glutathione; Deltathione; Glutathion; Glutinal; Neuthion; Tathione; Glutide; Ledac; Glutatiol; Glutatione; Panaron; L-Glutatione; Agifutol S; Υ-L-Glutamyl-L-cysteinylglycine; 5-L-Glutamyl-L-cysteinylglycine; L-Υ-Glutamyl-L-cysteinylglycine; Glycine, L-Υ-glutamyl-L-cysteinyl-; Υ-L-Glutamylcysteinylglycine; N-(N-Υ-L-Glutamyl-L-cysteinyl)glycine; Glycine, N-(N-L-Υ-glutamyl-L-cysteinyl)-; L-Glutamyl-L-cysteinylglycine; N-(N-L-Υ-Glutamyl-L-cysteinyl)glycine; Bakezyme RX |
| ChEMBL | CHEMBL1543 |
| ChemSpider | 111188 |
| Wikipedia | Glutathione |
| HMDb | HMDB00125 |
| ChEBI | CHEBI:16856 |
| ChemIDPlus | 061631707 |
| KEGG | C00051; C11367; D00014; C02471 |
| PubChem | 124886 |