Systematic / IUPAC Name: 2,6-Bis(4-methoxyphenyl)-3,5-dimethyl-4-piperidinone
ID: Reference4751
Other Names:
2,6-Bis(4-methoxyphenyl)-3,5-dimethylpiperidin-4-one;
4-Piperidinone, 2,6-bis(4-methoxyphenyl)-3,5-dimethyl-
Formula: C21H25NO3
2,6-Bis(4-methoxyphenyl)-3,5-dimethyltetrahydropyridin-4(1H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/10/2016 7:44:21 AM |
| InChI | InChI=1S/C21H25NO3/c1-13-19(15-5-9-17(24-3)10-6-15)22-20(14(2)21(13)23)16-7-11-18(25-4)12-8-16/h5-14,19-20,22H,1-4H3 |
| InChI Key | RVYZVGKIODSCSZ-UHFFFAOYSA-N |
| Canonical SMILES | CC1C(NC(C(C1=O)C)C2=CC=C(C=C2)OC)C3=CC=C(C=C3)OC |
| CAS | |
| Splash | |
| Other Names |
2,6-Bis(4-methoxyphenyl)-3,5-dimethylpiperidin-4-one; 4-Piperidinone, 2,6-bis(4-methoxyphenyl)-3,5-dimethyl- |
| PubChem | 367137 |
| ChEMBL | CHEMBL1719794 |
| ChemSpider | 325904 |