Systematic / IUPAC Name: 4-[2-(4-Chlorophenyl)-1,3-thiazol-4-yl]-5-methyl-3-phenyl-1,2-oxazole
ID: Reference4760
Other Names: Isoxazole, 4-[2-(4-chlorophenyl)-4-thiazolyl]-5-methyl-3-phenyl-
Formula: C19H13ClN2OS
4-[2-(4-Chlorophenyl)-1,3-thiazol-4-yl]-5-methyl-3-phenylisoxazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/10/2016 9:54:20 AM |
| InChI | InChI=1S/C19H13ClN2OS/c1-12-17(18(22-23-12)13-5-3-2-4-6-13)16-11-24-19(21-16)14-7-9-15(20)10-8-14/h2-11H,1H3 |
| InChI Key | RBAJUPRLRBMNCH-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C3=CSC(=N3)C4=CC=C(C=C4)Cl |
| CAS | |
| Splash | |
| Other Names | Isoxazole, 4-[2-(4-chlorophenyl)-4-thiazolyl]-5-methyl-3-phenyl- |