Systematic / IUPAC Name: 2-Amino-4-hydroxybutanoic acid
ID: Reference477
Other Names:
(S)-2-Amino-4-hydroxybutanoic acid;
(2S)-2-Amino-4-hydroxybutanoic acid;
Butanoic acid, 2-amino-4-hydroxy-, (S)-;
2-Amino-4-hydroxy-L-butyrate;
(S)-2-Amino-4-hydroxybutanoate
; more
Formula: C4H9NO3
Class: Endogenous Metabolites
L-Homoserine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 4 |
| No. of Spectra | 445 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 1/26/2015 2:49:48 PM |
| InChI | InChI=1S/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8)/t3-/m0/s1 |
| InChI Key | UKAUYVFTDYCKQA-VKHMYHEASA-N |
| Canonical SMILES | C(CO)C(C(=O)O)N |
| CAS | 672151 |
| Splash | |
| Other Names |
(S)-2-Amino-4-hydroxybutanoic acid; (2S)-2-Amino-4-hydroxybutanoic acid; Butanoic acid, 2-amino-4-hydroxy-, (S)-; 2-Amino-4-hydroxy-L-butyrate; (S)-2-Amino-4-hydroxybutanoate; 2-Amino-4-hydroxy-L-butyric acid; (S)-Homoserine; Hse |
| HMDb | HMDB00719 |
| ChemSpider | 12126 |
| Wikipedia | Homoserine |
| KEGG | C00263 |
| ChEMBL | CHEMBL11722 |
| ChemIDPlus | 000672151 |
| PubChem | 12647; 6971022 |
| ChEBI | CHEBI:15699; CHEBI:57476 |