Systematic / IUPAC Name: N'-{(E)-[2-(4-Methyl-1-piperazinyl)phenyl]methylene}nicotinohydrazide
ID: Reference4773
Other Names:
3-Pyridinecarboxylic acid, 2-{(1E)-[2-(4-methyl-1-piperazinyl)phenyl]methylene}hydrazide ;
N'-{[2-(4-Methylpiperazino)phenyl]methylene}nicotinohydrazide
Formula: C18H21N5O
N'-{[2-(4-Methylpiperazino)phenyl]methylene}nicotinohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/11/2016 7:18:16 AM |
| InChI | InChI=1S/C18H21N5O/c1-22-9-11-23(12-10-22)17-7-3-2-5-15(17)14-20-21-18(24)16-6-4-8-19-13-16/h2-8,13-14H,9-12H2,1H3,(H,21,24)/b20-14+ |
| InChI Key | GWFAFMMDWZWCKQ-XSFVSMFZSA-N |
| Canonical SMILES | CN1CCN(CC1)C2=CC=CC=C2C=NNC(=O)C3=CN=CC=C3 |
| CAS | |
| Splash | |
| Other Names |
3-Pyridinecarboxylic acid, 2-{(1E)-[2-(4-methyl-1-piperazinyl)phenyl]methylene}hydrazide ; N'-{[2-(4-Methylpiperazino)phenyl]methylene}nicotinohydrazide |
| ChemSpider | 7854829 |
| PubChem | 9580681 |
| ChEMBL | CHEMBL3190728 |