Systematic / IUPAC Name: 2-[(2H-Tetrazol-5-ylmethyl)sulfanyl]pyridine
ID: Reference4779
Other Names: Pyridine, 2-[(2H-tetrazol-5-ylmethyl)thio]-
Formula: C7H7N5S
2-[(1H-1,2,3,4-Tetraazol-5-ylmethyl)thio]pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/11/2016 8:17:25 AM |
| InChI | InChI=1S/C7H7N5S/c1-2-4-8-7(3-1)13-5-6-9-11-12-10-6/h1-4H,5H2,(H,9,10,11,12) |
| InChI Key | BQVSJNPYSGIKPW-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=NC(=C1)SCC2=NNN=N2 |
| CAS | |
| Splash | |
| Other Names | Pyridine, 2-[(2H-tetrazol-5-ylmethyl)thio]- |