Systematic / IUPAC Name: 5-Phenyl-7-{[5-(4-pyridinyl)-1,3,4-oxadiazol-2-yl]sulfanyl}[1,2,4]triazolo[1,5-a]pyrimidine
ID: Reference4830
Other Names: [1,2,4]Triazolo[1,5-a]pyrimidine, 5-phenyl-7-{[5-(4-pyridinyl)-1,3,4-oxadiazol-2-yl]thio}-
Formula: C18H11N7OS
5-Phenyl-7-{[5-(4-pyridinyl)-1,3,4-oxadiazol-2-yl]sulfanyl}[1,2,4]triazolo[1,5-a]pyrimidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 125 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/12/2016 1:37:05 PM |
| InChI | InChI=1S/C18H11N7OS/c1-2-4-12(5-3-1)14-10-15(25-17(22-14)20-11-21-25)27-18-24-23-16(26-18)13-6-8-19-9-7-13/h1-11H |
| InChI Key | AYRDJIJCARMIPU-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=NC3=NC=NN3C(=C2)SC4=NN=C(O4)C5=CC=NC=C5 |
| CAS | |
| Splash | |
| Other Names | [1,2,4]Triazolo[1,5-a]pyrimidine, 5-phenyl-7-{[5-(4-pyridinyl)-1,3,4-oxadiazol-2-yl]thio}- |