Systematic / IUPAC Name: 2-(4-Chlorophenyl)-4-(2,4-dimethyl-1,3-thiazol-5-yl)pyrimidine
ID: Reference4835
Other Names: Pyrimidine, 2-(4-chlorophenyl)-4-(2,4-dimethyl-5-thiazolyl)-
Formula: C15H12ClN3S
5-[2-(4-Chlorophenyl)pyrimidin-4-yl]-2,4-dimethyl-1,3-thiazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/13/2016 5:59:28 AM |
| InChI | InChI=1S/C15H12ClN3S/c1-9-14(20-10(2)18-9)13-7-8-17-15(19-13)11-3-5-12(16)6-4-11/h3-8H,1-2H3 |
| InChI Key | NSQGBYFDPYANCV-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(SC(=N1)C)C2=NC(=NC=C2)C3=CC=C(C=C3)Cl |
| CAS | |
| Splash | |
| Other Names | Pyrimidine, 2-(4-chlorophenyl)-4-(2,4-dimethyl-5-thiazolyl)- |