Systematic / IUPAC Name: ({2-[(1-Benzyl-4-piperidinyl)amino]-2-oxoethyl}sulfanyl)acetic acid
ID: Reference4842
Other Names: Acetic acid, 2-[(2-oxo-2-{[1-(phenylmethyl)-4-piperidinyl]amino}ethyl)thio]-
Formula: C16H22N2O3S
2-({2-[(1-Benzylpiperidin-4-yl)amino]-2-oxoethyl}thio)acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 5/13/2016 6:51:26 AM |
| InChI | InChI=1S/C16H22N2O3S/c19-15(11-22-12-16(20)21)17-14-6-8-18(9-7-14)10-13-4-2-1-3-5-13/h1-5,14H,6-12H2,(H,17,19)(H,20,21) |
| InChI Key | XGWLQPIKFDOHIQ-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CCC1NC(=O)CSCC(=O)O)CC2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names | Acetic acid, 2-[(2-oxo-2-{[1-(phenylmethyl)-4-piperidinyl]amino}ethyl)thio]- |