Systematic / IUPAC Name: 2-Amino-4-methylsulfinylbutanoic acid
ID: Reference487
Other Names:
Methionine sulfoxide;
2-Amino-4-(methylsulfinyl)butanoic acid;
Butanoic acid, 2-amino-4-(methylsulfinyl)-;
2-Amino-4-(methylsulfinyl)butyric acid;
(1)-2-Amino-4-(methylsulphinyl)butyric acid
Formula: C5H11NO3S
Class: Endogenous Metabolites
Methionine sulfoxide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 108 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/27/2015 2:01:41 PM |
| InChI | InChI=1S/C5H11NO3S/c1-10(9)3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
| InChI Key | QEFRNWWLZKMPFJ-UHFFFAOYSA-N |
| Canonical SMILES | CS(=O)CCC(C(=O)O)N |
| CAS | 62697738 |
| Splash | |
| Other Names |
Methionine sulfoxide; 2-Amino-4-(methylsulfinyl)butanoic acid; Butanoic acid, 2-amino-4-(methylsulfinyl)-; 2-Amino-4-(methylsulfinyl)butyric acid; (1)-2-Amino-4-(methylsulphinyl)butyric acid |
| HMDb | HMDB02005; HMDB02005 |
| ChemIDPlus | 000454411; 003226651; 062697738 |
| ChemSpider | 824 |
| ChEBI | CHEBI:49033 |
| PubChem | 847 |
| Wikipedia | Methionine sulfoxide |