Systematic / IUPAC Name: 3,4,5-Trihydroxy-6-[(9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7-yl)oxy]oxane-2-carboxylic acid
ID: Reference494
Other Names:
β-D-Glucopyranosiduronic acid, (5α,6α)-7,8-didehydro-4,5-epoxy-3-hydroxy-17-methylmorphinan-6-yl;
Morphine-6-glucuronide;
Morphine 6-β-D-glucopyranosiduronide
Formula: C23H27NO9
Class: Drugs of Abuse/Illegal Drugs
Morphine 6-β-D-glucuronide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 271 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/28/2015 10:36:16 AM |
| InChI | InChI=1S/C23H27NO9/c1-24-7-6-23-10-3-5-13(31-22-17(28)15(26)16(27)19(33-22)21(29)30)20(23)32-18-12(25)4-2-9(14(18)23)8-11(10)24/h2-5,10-11,13,15-17,19-20,22,25-28H,6-8H2,1H3,(H,29,30)/t10-,11+,13-,15-,16-,17+,19-,20-,22+,23-/m0/s1 |
| InChI Key | GNJCUHZOSOYIEC-GAROZEBRSA-N |
| Canonical SMILES | O=C(O)C6OC(OC1/C=C\C5C24c3c(ccc(O)c3OC12)CC5N(C)CC4)C(O)C(O)C6O |
| CAS | 20290102 |
| Splash | |
| Other Names |
β-D-Glucopyranosiduronic acid, (5α,6α)-7,8-didehydro-4,5-epoxy-3-hydroxy-17-methylmorphinan-6-yl; Morphine-6-glucuronide; Morphine 6-β-D-glucopyranosiduronide |
| ChemIDPlus | 020290102 |
| Wikipedia | Morphine-6-glucuronide |
| ChemSpider | 4514548 |
| PubChem | 5360621 |
| ChEMBL | CHEMBL1330 |
| HMDb | HMDB41937 |
| KEGG | C16578 |