Systematic / IUPAC Name: 2-(2-Methoxyphenyl)-1-(1-pentyl-1H-indol-3-yl)ethanone
ID: Reference4965
Other Names: 2-(2-Methoxyphenyl)-1-(1-pentylindol-3-yl)ethanone
Formula: C22H25NO2
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
JWH-250 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/4/2016 12:08:59 PM |
| InChI | InChI=1S/C22H25NO2/c1-3-4-9-14-23-16-19(18-11-6-7-12-20(18)23)21(24)15-17-10-5-8-13-22(17)25-2/h5-8,10-13,16H,3-4,9,14-15H2,1-2H3 |
| InChI Key | FFLSJIQJQKDDCM-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCN1C=C(C2=CC=CC=C21)C(=O)CC3=CC=CC=C3OC |
| CAS | 864445432 |
| Splash | |
| Other Names | 2-(2-Methoxyphenyl)-1-(1-pentylindol-3-yl)ethanone |
| PubChem | 44397540 |
| ChemSpider | 23256117 |
| ChEMBL | CHEMBL188031 |
| Wikipedia | JWH-250 |