Systematic / IUPAC Name: 2-(Dimethylamino)acetic acid
ID: Reference498
Other Names:
Dimethylglycine;
Glycine, N,N-dimethyl-;
(Dimethylamino)acetic acid;
N,N-Dimethylaminoacetic acid;
N-Methylsarcosine
Formula: C4H9NO2
Class: Endogenous Metabolites
N,N-Dimethylglycine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 409 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 10/11/2016 12:44:29 PM |
| InChI | InChI=1S/C4H9NO2/c1-5(2)3-4(6)7/h3H2,1-2H3,(H,6,7) |
| InChI Key | FFDGPVCHZBVARC-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)CC(=O)O |
| CAS | 1118689 |
| Splash | |
| Other Names |
Dimethylglycine; Glycine, N,N-dimethyl-; (Dimethylamino)acetic acid; N,N-Dimethylaminoacetic acid; N-Methylsarcosine; N-Methylsarcosine N,N-dimethyl-glycine |
| HMDb | HMDB00092 |
| ChEBI | CHEBI:17724; CHEBI:58251 |
| ChemSpider | 653 |
| Wikipedia | Dimethylglycine |
| PubChem | 673 |
| ChemIDPlus | 001118689; 017647868; 018319885 |
| KEGG | C01026 |