Systematic / IUPAC Name: 1-[1-(4-Methoxyphenyl)cyclohexyl]piperidine
ID: Reference5062
Other Names:
4-Methoxyphencyclidine;
Piperidine, 1-[1-(4-methoxyphenyl)cyclohexyl]-
Formula: C18H27NO
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
4-Methoxy PCP mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/30/2016 8:41:05 AM |
| InChI | InChI=1S/C18H27NO/c1-20-17-10-8-16(9-11-17)18(12-4-2-5-13-18)19-14-6-3-7-15-19/h8-11H,2-7,12-15H2,1H3 |
| InChI Key | MUZGGFNYVLGUFS-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)C2(CCCCC2)N3CCCCC3 |
| CAS | |
| Splash | |
| Other Names |
4-Methoxyphencyclidine; Piperidine, 1-[1-(4-methoxyphenyl)cyclohexyl]- |
| PubChem | 15100753 |
| ChEMBL | CHEMBL1760302 |
| Wikipedia | 4-MeO-PCP |
| ChemSpider | 10526416 |