Systematic / IUPAC Name: (2-Iodophenyl)(1-pentyl-1H-indol-3-yl)methanone
ID: Reference5074
Other Names:
AM-679 ;
1-Pentyl-3-(2-iodobenzoyl)indole;
Methanone, (2-iodophenyl)(1-pentyl-1H-indol-3-yl)-
Formula: C20H20INO
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
AM679 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/1/2016 10:50:55 AM |
| InChI | InChI=1S/C20H20INO/c1-2-3-8-13-22-14-17(15-9-5-7-12-19(15)22)20(23)16-10-4-6-11-18(16)21/h4-7,9-12,14H,2-3,8,13H2,1H3 |
| InChI Key | GAJBHYUAJOTAEW-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCN1C=C(C2=CC=CC=C21)C(=O)C3=CC=CC=C3I |
| CAS | 335160913 |
| Splash | |
| Other Names |
AM-679 ; 1-Pentyl-3-(2-iodobenzoyl)indole; Methanone, (2-iodophenyl)(1-pentyl-1H-indol-3-yl)- |
| PubChem | 57458891 |
| Wikipedia | AM-679 (cannabinoid) |
| ChemSpider | 25991468 |