Systematic / IUPAC Name: (1-Heptyl-5-phenyl-1H-pyrrol-3-yl)(1-naphthyl)methanone
ID: Reference5093
Other Names:
(1-Heptyl-5-phenyl-1H-pyrrol-3-yl)(naphthalen-1-yl)methanone;
Methanone, (1-heptyl-5-phenyl-1H-pyrrol-3-yl)-1-naphthalenyl-
Formula: C28H29NO
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
JWH 146 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/8/2016 6:53:03 AM |
| InChI | InChI=1S/C28H29NO/c1-2-3-4-5-11-19-29-21-24(20-27(29)23-14-7-6-8-15-23)28(30)26-18-12-16-22-13-9-10-17-25(22)26/h6-10,12-18,20-21H,2-5,11,19H2,1H3 |
| InChI Key | JDBFNFBWXVCTSA-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCN1C=C(C=C1C2=CC=CC=C2)C(=O)C3=CC=CC4=CC=CC=C43 |
| CAS | 914458212 |
| Splash | |
| Other Names |
(1-Heptyl-5-phenyl-1H-pyrrol-3-yl)(naphthalen-1-yl)methanone; Methanone, (1-heptyl-5-phenyl-1H-pyrrol-3-yl)-1-naphthalenyl- |
| PubChem | 44418308 |
| ChemSpider | 23277883 |
| ChEMBL | CHEMBL219970 |