Systematic / IUPAC Name: 1-Phenyl-2-pyrrolidin-1-ylnonan-1-one
ID: Reference5096
Other Names:
α-PNP ;
PV-10
Formula: C19H29NO
Class: Drugs of Abuse/Illegal Drugs
α-Pyrrolidinononanophenone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/11/2016 7:36:16 AM |
| InChI | 1S/C19H29NO/c1-2-3-4-5-9-14-18(20-15-10-11-16-20)19(21)17-12-7-6-8-13-17/h6-8,12-13,18H,2-5,9-11,14-16H2,1H3 |
| InChI Key | RYJXAZXFWIWTOJ-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCC(C(=O)C1=CC=CC=C1)N2CCCC2 |
| CAS | |
| Splash | |
| Other Names |
α-PNP ; PV-10 |
| PubChem | 69247748 |