Systematic / IUPAC Name: 2-(methylaminomethyl)-3,4-dihydro-2H-naphthalen-1-one
ID: Reference5098
Other Names:
Formula: C12H15NO
Class: Drugs of Abuse/Illegal Drugs
MTTA mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/11/2016 7:34:40 AM |
| InChI | InChI=1S/C12H15NO/c1-13-8-10-7-6-9-4-2-3-5-11(9)12(10)14/h2-5,10,13H,6-8H2,1H3 |
| InChI Key | FTRWLSZFQILOOD-UHFFFAOYSA-N |
| Canonical SMILES | CNCC1CCC2=CC=CC=C2C1=O |
| CAS | |
| Splash | |
| Other Names |
| PubChem | 69845357 |