Systematic / IUPAC Name: 1-Naphthyl(1-pentyl-1H-pyrrol-3-yl)methanone
ID: Reference5131
Other Names:
Naphthalen-1-yl(1-pentyl-1H-pyrrol-3-yl)methanone;
JWH 030
Formula: C20H21NO
Class: Drugs of Abuse/Illegal Drugs
JWH-030 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/12/2016 8:59:32 AM |
| InChI | InChI=1S/C20H21NO/c1-2-3-6-13-21-14-12-17(15-21)20(22)19-11-7-9-16-8-4-5-10-18(16)19/h4-5,7-12,14-15H,2-3,6,13H2,1H3 |
| InChI Key | VPBJQDBKZSHCPC-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCN1C=CC(=C1)C(=O)C2=CC=CC3=CC=CC=C32 |
| CAS | 162934738 |
| Splash | |
| Other Names |
Naphthalen-1-yl(1-pentyl-1H-pyrrol-3-yl)methanone; JWH 030 |
| PubChem | 9971539 |
| ChEMBL | CHEMBL71810 |
| Wikipedia | JWH-030 |
| ChemSpider | 8147131 |