Systematic / IUPAC Name: 3-(1,3-Benzodioxol-5-yl)-N,2-dimethylpropan-1-amine
ID: Reference5135
            Other Names: 
                    3,4-Methylenedioxymethamphetamine methyl homolog ; 
                    N,β-Dimethyl-1,3-benzodioxole-5-propanamine 
        
Formula: C12H17NO2
Class: Drugs of Abuse/Illegal Drugs
MDMA Methylene homolog mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap | 
| No. of Spectral Trees | 1 | 
| No. of Spectra | 119 | 
| Tandem Spectra | MS1, MS2 | 
| Ionization Methods | ESI | 
| Analyzers | FT | 
| Last Modification | 7/12/2016 11:14:31 AM | 
| InChI | InChI=1S/C12H17NO2/c1-9(7-13-2)5-10-3-4-11-12(6-10)15-8-14-11/h3-4,6,9,13H,5,7-8H2,1-2H3 | 
| InChI Key | OUDAACSONIJLOT-UHFFFAOYSA-N | 
| Canonical SMILES | CC(CC1=CC2=C(C=C1)OCO2)CNC | 
| CAS | |
| Splash | |
| Other Names | 3,4-Methylenedioxymethamphetamine methyl homolog ; N,β-Dimethyl-1,3-benzodioxole-5-propanamine | 
| PubChem | 82672270 |