Systematic / IUPAC Name: 4-{2-[(4-Chlorophenoxy)methyl]-1,3-thiazol-4-yl}-5-methyl-1,2-oxazole-3-carbohydrazide
ID: Reference5226
Other Names: 3-Isoxazolecarboxylic acid, 4-{2-[(4-chlorophenoxy)methyl]-4-thiazolyl}-5-methyl-, hydrazide
Formula: C15H13ClN4O3S
4-{2-[(4-Chlorophenoxy)methyl]-1,3-thiazol-4-yl}-5-methyl-3-isoxazolecarbohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 199 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/21/2016 1:12:55 PM |
| InChI | InChI=1S/C15H13ClN4O3S/c1-8-13(14(20-23-8)15(21)19-17)11-7-24-12(18-11)6-22-10-4-2-9(16)3-5-10/h2-5,7H,6,17H2,1H3,(H,19,21) |
| InChI Key | YJKASRAMMWDASY-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=NO1)C(=O)NN)C2=CSC(=N2)COC3=CC=C(C=C3)Cl |
| CAS | |
| Splash | |
| Other Names | 3-Isoxazolecarboxylic acid, 4-{2-[(4-chlorophenoxy)methyl]-4-thiazolyl}-5-methyl-, hydrazide |
| PubChem | 2745260 |
| ChemSpider | 2026743 |
| ChEMBL | CHEMBL1495065 |