Systematic / IUPAC Name: 2-(1-Ethyl-3-methyl-1H-pyrazol-5-yl)-5-(4-methylphenyl)-1,3,4-oxadiazole
ID: Reference5233
Other Names: 1,3,4-Oxadiazole, 2-(1-ethyl-3-methyl-1H-pyrazol-5-yl)-5-(4-methylphenyl)-
Formula: C15H16N4O
2-(1-Ethyl-3-methyl-1H-pyrazol-5-yl)-5-(4-methylphenyl)-1,3,4-oxadiazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/22/2016 7:56:24 AM |
| InChI | InChI=1S/C15H16N4O/c1-4-19-13(9-11(3)18-19)15-17-16-14(20-15)12-7-5-10(2)6-8-12/h5-9H,4H2,1-3H3 |
| InChI Key | IHWDRLRKSDLWCY-UHFFFAOYSA-N |
| Canonical SMILES | CCN1C(=CC(=N1)C)C2=NN=C(O2)C3=CC=C(C=C3)C |
| CAS | |
| Splash | |
| Other Names | 1,3,4-Oxadiazole, 2-(1-ethyl-3-methyl-1H-pyrazol-5-yl)-5-(4-methylphenyl)- |