Systematic / IUPAC Name: 2-Phenylacetohydrazide
ID: Reference5245
Other Names:
(2-Phenylacetyl)hydrazine;
2-Phenylacetic acid hydrazide;
Acetic acid, phenyl-, hydrazide;
Phenacetic acid hydrazide;
Phenylacethydrazide
; more
Formula: C8H10N2O
2-Phenylacetohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/22/2016 12:01:03 PM |
| InChI | InChI=1S/C8H10N2O/c9-10-8(11)6-7-4-2-1-3-5-7/h1-5H,6,9H2,(H,10,11) |
| InChI Key | FPTCVTJCJMVIDV-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)CC(=O)NN |
| CAS | 937393 |
| Splash | |
| Other Names |
(2-Phenylacetyl)hydrazine; 2-Phenylacetic acid hydrazide; Acetic acid, phenyl-, hydrazide; Phenacetic acid hydrazide; Phenylacethydrazide; Phenylacetic acid hydrazide; Phenylacetichydrazide; Phenylacetohydrazide; Phenylacetyl hydrazide; Phenylacetylhydrazine |