Systematic / IUPAC Name: 5-Methoxy-8,8-dimethyl-2-phenyl-2,3-dihydro-4H,8H-pyrano[2,3-f]chromen-4-one
ID: Reference5250
Other Names:
4H,8H-Benzo[1,2-b:3,4-b']dipyran-4-one, 2,3-dihydro-5-methoxy-8,8-dimethyl-2-phenyl-;
Obovatin methyl ether
Formula: C21H20O4
5-Methoxy-8,8-dimethyl-2-phenyl-3,4-dihydro-2H,8H-pyrano[2,3-f]chromen-4-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/25/2016 9:34:52 AM |
| InChI | InChI=1S/C21H20O4/c1-21(2)10-9-14-17(25-21)12-18(23-3)19-15(22)11-16(24-20(14)19)13-7-5-4-6-8-13/h4-10,12,16H,11H2,1-3H3 |
| InChI Key | ITOTUSMHIQFNHJ-UHFFFAOYSA-N |
| Canonical SMILES | CC1(C=CC2=C3C(=C(C=C2O1)OC)C(=O)CC(O3)C4=CC=CC=C4)C |
| CAS | |
| Splash | |
| Other Names |
4H,8H-Benzo[1,2-b:3,4-b']dipyran-4-one, 2,3-dihydro-5-methoxy-8,8-dimethyl-2-phenyl-; Obovatin methyl ether |