Systematic / IUPAC Name: (4-Methyl-1-piperazinyl)(1-pentyl-1H-indol-3-yl)methanone
ID: Reference5295
Other Names:
Methanone, (4-methyl-1-piperazinyl)(1-pentyl-1H-indol-3-yl)-;
JWH 018-4(methylpiperazine)
Formula: C19H27N3O
Class: Drugs of Abuse/Illegal Drugs
Mepirapim mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/27/2016 7:23:39 AM |
| InChI | InChI=1S/C19H27N3O/c1-3-4-7-10-22-15-17(16-8-5-6-9-18(16)22)19(23)21-13-11-20(2)12-14-21/h5-6,8-9,15H,3-4,7,10-14H2,1-2H3 |
| InChI Key | IUEFFEOHJKCBPF-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCN1C=C(C2=CC=CC=C21)C(=O)N3CCN(CC3)C |
| CAS | |
| Splash | |
| Other Names |
Methanone, (4-methyl-1-piperazinyl)(1-pentyl-1H-indol-3-yl)-; JWH 018-4(methylpiperazine) |