Systematic / IUPAC Name: 1-(1,2-Diphenylethyl)piperidine
ID: Reference5300
Other Names:
Piperidine, 1-(1,2-diphenylethyl)-;
DEP
Formula: C19H23N
Class: Drugs of Abuse/Illegal Drugs
Diphenidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/27/2016 8:27:37 AM |
| InChI | InChI=1S/C19H23N/c1-4-10-17(11-5-1)16-19(18-12-6-2-7-13-18)20-14-8-3-9-15-20/h1-2,4-7,10-13,19H,3,8-9,14-16H2 |
| InChI Key | JQWJJJYHVHNXJH-UHFFFAOYSA-N |
| Canonical SMILES | C1CCN(CC1)C(CC2=CC=CC=C2)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names |
Piperidine, 1-(1,2-diphenylethyl)-; DEP |
| PubChem | 206666 |
| ChemSpider | 179031 |
| Wikipedia | Diphenidine |