Systematic / IUPAC Name: 1-[1-(2-Methoxyphenyl)-2-phenylethyl]piperidine
ID: Reference5304
Other Names:
Piperidine, 1-[1-(2-methoxyphenyl)-2-phenylethyl]-;
2-MeO-Diphenidine ;
MXP
Formula: C20H25NO
Class: Drugs of Abuse/Illegal Drugs
Methoxphenidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/27/2016 10:47:37 AM |
| InChI | InChI=1S/C20H25NO/c1-22-20-13-7-6-12-18(20)19(21-14-8-3-9-15-21)16-17-10-4-2-5-11-17/h2,4-7,10-13,19H,3,8-9,14-16H2,1H3 |
| InChI Key | QXXCUXIRBHSITD-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=CC=C1C(CC2=CC=CC=C2)N3CCCCC3 |
| CAS | |
| Splash | |
| Other Names |
Piperidine, 1-[1-(2-methoxyphenyl)-2-phenylethyl]-; 2-MeO-Diphenidine ; MXP |
| ChemSpider | 52085156 |
| PubChem | 67833251 |
| Wikipedia | Methoxphenidine |