Systematic / IUPAC Name: (1-Pentyl-1H-indol-3-yl)(4-propyl-1-naphthyl)methanone
ID: Reference5328
Other Names:
(1-Pentyl-1H-indol-3-yl)(4-propylnaphthalen-1-yl)methanone;
Methanone, (1-pentyl-1H-indol-3-yl)(4-propyl-1-naphthalenyl)-
Formula: C27H29NO
Class: Drugs of Abuse/Illegal Drugs
JWH 182 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/28/2016 11:01:33 AM |
| InChI | InChI=1S/C27H29NO/c1-3-5-10-18-28-19-25(23-14-8-9-15-26(23)28)27(29)24-17-16-20(11-4-2)21-12-6-7-13-22(21)24/h6-9,12-17,19H,3-5,10-11,18H2,1-2H3 |
| InChI Key | AKGUMDFQXWZHHS-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCN1C=C(C2=CC=CC=C21)C(=O)C3=CC=C(C4=CC=CC=C43)CCC |
| CAS | 824960023 |
| Splash | |
| Other Names |
(1-Pentyl-1H-indol-3-yl)(4-propylnaphthalen-1-yl)methanone; Methanone, (1-pentyl-1H-indol-3-yl)(4-propyl-1-naphthalenyl)- |
| ChEMBL | CHEMBL564302 |
| ChemSpider | 24627562 |
| PubChem | 45268702 |