Systematic / IUPAC Name: [5-(2-Methylphenyl)-1-pentyl-1H-pyrrol-3-yl](1-naphthyl)methanone
ID: Reference5334
Other Names:
[5-(2-Methylphenyl)-1-pentyl-1H-pyrrol-3-yl]-1-naphthalenyl-methanone;
Methanone, [5-(2-methylphenyl)-1-pentyl-1H-pyrrol-3-yl]-1-naphthalenyl-;
Naphthalen-1-yl(1-pentyl-5-o-tolyl-1H-pyrrol-3-yl)methanone;
JWH 370
Formula: C27H27NO
Class: Drugs of Abuse/Illegal Drugs
JWH-370 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/28/2016 12:08:07 PM |
| InChI | InChI=1S/C27H27NO/c1-3-4-9-17-28-19-22(18-26(28)23-14-7-5-11-20(23)2)27(29)25-16-10-13-21-12-6-8-15-24(21)25/h5-8,10-16,18-19H,3-4,9,17H2,1-2H3 |
| InChI Key | HZMLAMXVETUEJZ-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCN1C=C(C=C1C2=CC=CC=C2C)C(=O)C3=CC=CC4=CC=CC=C43 |
| CAS | 914458223 |
| Splash | |
| Other Names |
[5-(2-Methylphenyl)-1-pentyl-1H-pyrrol-3-yl]-1-naphthalenyl-methanone; Methanone, [5-(2-methylphenyl)-1-pentyl-1H-pyrrol-3-yl]-1-naphthalenyl-; Naphthalen-1-yl(1-pentyl-5-o-tolyl-1H-pyrrol-3-yl)methanone; JWH 370 |
| PubChem | 44418312 |
| ChemSpider | 23277889 |
| ChEMBL | CHEMBL220180 |