Systematic / IUPAC Name: 4-Methoxybenzoic acid
ID: Reference534
Other Names:
Benzoic acid, 4-methoxy-;
p-Methoxybenzoic acid;
Methoxybenzoic acid;
p-Methoxybenzoate;
p-Anisic acid
; more
Formula: C8H8O3
Class: Endogenous Metabolites
4-Anisic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 275 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/11/2016 1:46:41 PM |
| InChI | InChI=1S/C8H8O3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10) |
| InChI Key | ZEYHEAKUIGZSGI-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)C(=O)O |
| CAS | 100094 |
| Splash | |
| Other Names |
Benzoic acid, 4-methoxy-; p-Methoxybenzoic acid; Methoxybenzoic acid; p-Methoxybenzoate; p-Anisic acid; Draconic acid; Anisic acid; 4-Carboxyanisole |
| ChEBI | CHEBI:40813 |
| Wikipedia | p-Anisic acid |
| ChemSpider | 10181338 |
| ChEMBL | CHEMBL21932 |
| KEGG | C02519 |
| HMDb | HMDB01101 |
| PubChem | 7478 |