Systematic / IUPAC Name: (4-Ethyl-1-naphthyl)(2-methyl-1-pentyl-1H-indol-3-yl)methanone
ID: Reference5370
Other Names:
Methanone, (4-ethyl-1-naphthalenyl)(2-methyl-1-pentyl-1H-indol-3-yl)-;
JWH-213
Formula: C27H29NO
Class: Drugs of Abuse/Illegal Drugs
JWH 213 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/1/2016 12:31:48 PM |
| InChI | InChI=1S/C27H29NO/c1-4-6-11-18-28-19(3)26(24-14-9-10-15-25(24)28)27(29)23-17-16-20(5-2)21-12-7-8-13-22(21)23/h7-10,12-17H,4-6,11,18H2,1-3H3 |
| InChI Key | JAVDQKMSPNBPCK-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCN1C(=C(C2=CC=CC=C21)C(=O)C3=CC=C(C4=CC=CC=C43)CC)C |
| CAS | 824959833 |
| Splash | |
| Other Names |
Methanone, (4-ethyl-1-naphthalenyl)(2-methyl-1-pentyl-1H-indol-3-yl)-; JWH-213 |
| ChemSpider | 24629482 |
| PubChem | 45268707 |
| ChEMBL | CHEMBL564622 |