Systematic / IUPAC Name: (4-Methyl-1-naphthyl)(2-methyl-1-pentyl-1H-indol-3-yl)methanone
ID: Reference5388
Other Names:
JWH 149 ;
2-Methyl-3-(4-methylnaphthalene-1-carbonyl)-1-pentylindole;
Methanone, (4-methyl-1-naphthalenyl)(2-methyl-1-pentyl-1H-indol-3-yl)-
Formula: C26H27NO
Class: Drugs of Abuse/Illegal Drugs
JWH-149 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/3/2016 7:27:10 AM |
| InChI | InChI=1S/C26H27NO/c1-4-5-10-17-27-19(3)25(23-13-8-9-14-24(23)27)26(28)22-16-15-18(2)20-11-6-7-12-21(20)22/h6-9,11-16H,4-5,10,17H2,1-3H3 |
| InChI Key | JTJAMXUOXJGSCW-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCN1C(=C(C2=CC=CC=C21)C(=O)C3=CC=C(C4=CC=CC=C43)C)C |
| CAS | 548461821 |
| Splash | |
| Other Names |
JWH 149 ; 2-Methyl-3-(4-methylnaphthalene-1-carbonyl)-1-pentylindole; Methanone, (4-methyl-1-naphthalenyl)(2-methyl-1-pentyl-1H-indol-3-yl)- |
| Wikipedia | JWH-149 |
| PubChem | 45267820 |
| ChemSpider | 24627235 |
| ChEMBL | CHEMBL561090 |