Systematic / IUPAC Name: (4-Methoxy-1-naphthyl){1-[2-(4-morpholinyl)ethyl]-1H-indol-3-yl}methanone
ID: Reference5389
Other Names:
JWH 198;
(4-Methoxy-naphthalen-1-yl)-[1-(2-morpholin-4-yl-ethyl)-1H-indol-3-yl]-methanone;
Methanone, (4-methoxy-1-naphthalenyl){1-[2-(4-morpholinyl)ethyl]-1H-indol-3-yl}-
Formula: C26H26N2O3
Class: Drugs of Abuse/Illegal Drugs
JWH-198 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/3/2016 7:29:41 AM |
| InChI | InChI=1S/C26H26N2O3/c1-30-25-11-10-22(19-6-2-3-8-21(19)25)26(29)23-18-28(24-9-5-4-7-20(23)24)13-12-27-14-16-31-17-15-27/h2-11,18H,12-17H2,1H3 |
| InChI Key | QWHSUXWDDKWTOG-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C2=CC=CC=C21)C(=O)C3=CN(C4=CC=CC=C43)CCN5CCOCC5 |
| CAS | 166599764 |
| Splash | |
| Other Names |
JWH 198; (4-Methoxy-naphthalen-1-yl)-[1-(2-morpholin-4-yl-ethyl)-1H-indol-3-yl]-methanone; Methanone, (4-methoxy-1-naphthalenyl){1-[2-(4-morpholinyl)ethyl]-1H-indol-3-yl}- |
| PubChem | 10319620 |
| Wikipedia | JWH-198 |
| ChemSpider | 8495084 |
| ChEMBL | CHEMBL81473 |