Systematic / IUPAC Name: 2-[(2-Phenylacetyl)amino]acetic acid
ID: Reference540
Other Names:
N-Phenylacetylglycine;
N-(Phenylacetyl)glycine;
Glycine, N-(phenylacetyl)-;
2-(2-Phenylacetamido)acetic acid;
[(Phenylacetyl)amino]acetic acid
; more
Formula: C10H11NO3
Class: Endogenous Metabolites
Phenylacetylglycine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 241 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/3/2015 2:49:36 PM |
| InChI | InChI=1S/C10H11NO3/c12-9(11-7-10(13)14)6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,12)(H,13,14) |
| InChI Key | UTYVDVLMYQPLQB-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)CC(=O)NCC(=O)O |
| CAS | 500981 |
| Splash | |
| Other Names |
N-Phenylacetylglycine; N-(Phenylacetyl)glycine; Glycine, N-(phenylacetyl)-; 2-(2-Phenylacetamido)acetic acid; [(Phenylacetyl)amino]acetic acid; 2-(2-Phenylacetylamino)acetic acid; Phenylacetyl glycine; Phenaceturic acid; Phenacetylglycine; N-Phenacetylglycine |
| ChEBI | CHEBI:27480 |
| ChemSpider | 61452 |
| HMDb | HMDB00821 |
| KEGG | C05598 |
| ChEMBL | CHEMBL458497 |
| PubChem | 68144 |
| ChemIDPlus | 000500981 |