Systematic / IUPAC Name: 1-Naphthyl 1-pentyl-1H-indazole-3-carboxylate
ID: Reference5402
Other Names:
1H-Indazole-3-carboxylic acid, 1-pentyl-, 1-naphthalenyl ester;
Naphthalen-1-yl 1-pentyl-1H-indazole-3-carboxylate
Formula: C23H22N2O2
Class: Drugs of Abuse/Illegal Drugs
SDB-005 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/3/2016 12:08:01 PM |
| InChI | InChI=1S/C23H22N2O2/c1-2-3-8-16-25-20-14-7-6-13-19(20)22(24-25)23(26)27-21-15-9-11-17-10-4-5-12-18(17)21/h4-7,9-15H,2-3,8,16H2,1H3 |
| InChI Key | JBVNFKZVDLFOAY-UHFFFAOYSA-N |
| Canonical SMILES | O=C(OC1=C(C=CC=C2)C2=CC=C1)C3=NN(CCCCC)C4=CC=CC=C43 |
| CAS | |
| Splash | |
| Other Names |
1H-Indazole-3-carboxylic acid, 1-pentyl-, 1-naphthalenyl ester; Naphthalen-1-yl 1-pentyl-1H-indazole-3-carboxylate |